EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H63N11O20 |
| Net Charge | 0 |
| Average Mass | 969.957 |
| Monoisotopic Mass | 969.42508 |
| SMILES | CCCCCCC[C@@H](O)CC(=O)NCC(=O)N[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](C(=O)N[C@H](CCCN(O)N=O)C(=O)N[C@@H](CO)C(=O)N[C@H](CCCN(O)N=O)C(=O)O)[C@@H](C)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C36H63N11O20/c1-3-4-5-6-7-10-20(51)15-25(52)37-16-26(53)42-28(29(54)36(62)63)34(59)41-24(18-49)32(57)43-27(19(2)50)33(58)38-21(11-8-13-46(66)44-64)30(55)40-23(17-48)31(56)39-22(35(60)61)12-9-14-47(67)45-65/h19-24,27-29,48-51,54,66-67H,3-18H2,1-2H3,(H,37,52)(H,38,58)(H,39,56)(H,40,55)(H,41,59)(H,42,53)(H,43,57)(H,60,61)(H,62,63)/t19-,20-,21-,22-,23+,24+,27-,28-,29-/m1/s1 |
| InChIKey | LKAAHWJXJKOYFO-PEFXTSJUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraburkholderia megapolitana (ncbitaxon:420953) | - | PubMed (31276269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Megapolibactin D (CHEBI:226472) is a peptide (CHEBI:16670) |