EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H71N11O19 |
| Net Charge | 0 |
| Average Mass | 1010.066 |
| Monoisotopic Mass | 1009.49277 |
| SMILES | CCCCCCCCCCC[C@@H](O)CC(=O)NCC(=O)N[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](C(=O)N[C@H](CCCN(O)N=O)C(=O)N[C@@H](C)C(=O)N[C@H](CCCN(O)N=O)C(=O)O)[C@@H](C)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C40H71N11O19/c1-4-5-6-7-8-9-10-11-12-15-25(54)20-29(55)41-21-30(56)46-32(33(57)40(65)66)38(62)45-28(22-52)36(60)47-31(24(3)53)37(61)43-26(16-13-18-50(69)48-67)35(59)42-23(2)34(58)44-27(39(63)64)17-14-19-51(70)49-68/h23-28,31-33,52-54,57,69-70H,4-22H2,1-3H3,(H,41,55)(H,42,59)(H,43,61)(H,44,58)(H,45,62)(H,46,56)(H,47,60)(H,63,64)(H,65,66)/t23-,24+,25+,26+,27+,28-,31+,32+,33+/m0/s1 |
| InChIKey | KOWVQDYFCAUUBM-CRXOGFNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraburkholderia megapolitana (ncbitaxon:420953) | - | PubMed (31276269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Megapolibactin C (CHEBI:226469) is a peptide (CHEBI:16670) |