EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H67N11O19 |
| Net Charge | 0 |
| Average Mass | 982.012 |
| Monoisotopic Mass | 981.46147 |
| SMILES | CCCCCCCCC[C@@H](O)CC(=O)NCC(=O)N[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](C(=O)N[C@H](CCCN(O)N=O)C(=O)N[C@@H](C)C(=O)N[C@H](CCCN(O)N=O)C(=O)O)[C@@H](C)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C38H67N11O19/c1-4-5-6-7-8-9-10-13-23(52)18-27(53)39-19-28(54)44-30(31(55)38(63)64)36(60)43-26(20-50)34(58)45-29(22(3)51)35(59)41-24(14-11-16-48(67)46-65)33(57)40-21(2)32(56)42-25(37(61)62)15-12-17-49(68)47-66/h21-26,29-31,50-52,55,67-68H,4-20H2,1-3H3,(H,39,53)(H,40,57)(H,41,59)(H,42,56)(H,43,60)(H,44,54)(H,45,58)(H,61,62)(H,63,64)/t21-,22+,23+,24+,25+,26-,29+,30+,31+/m0/s1 |
| InChIKey | RGCKNHXAIUCLAC-UDJPLWHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraburkholderia megapolitana (ncbitaxon:420953) | - | PubMed (31276269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Megapolibactin B (CHEBI:226465) is a peptide (CHEBI:16670) |