EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H63N11O19 |
| Net Charge | 0 |
| Average Mass | 953.958 |
| Monoisotopic Mass | 953.43017 |
| SMILES | CCCCCCC[C@@H](O)CC(=O)NCC(=O)N[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](C(=O)N[C@H](CCCN(O)N=O)C(=O)N[C@@H](C)C(=O)N[C@H](CCCN(O)N=O)C(=O)O)[C@@H](C)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C36H63N11O19/c1-4-5-6-7-8-11-21(50)16-25(51)37-17-26(52)42-28(29(53)36(61)62)34(58)41-24(18-48)32(56)43-27(20(3)49)33(57)39-22(12-9-14-46(65)44-63)31(55)38-19(2)30(54)40-23(35(59)60)13-10-15-47(66)45-64/h19-24,27-29,48-50,53,65-66H,4-18H2,1-3H3,(H,37,51)(H,38,55)(H,39,57)(H,40,54)(H,41,58)(H,42,52)(H,43,56)(H,59,60)(H,61,62)/t19-,20+,21+,22+,23+,24-,27+,28+,29+/m0/s1 |
| InChIKey | IJKDECQEZBZGBZ-HRUAGVTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraburkholderia megapolitana (ncbitaxon:420953) | - | PubMed (31276269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Megapolibactin A (CHEBI:226461) is a peptide (CHEBI:16670) |