EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O2 |
| Net Charge | 0 |
| Average Mass | 298.386 |
| Monoisotopic Mass | 298.16813 |
| SMILES | CC(=O)O[C@H]1[C@@H]2c3cccc4ncc(c34)C[C@H]2N(C)C[C@@H]1C |
| InChI | InChI=1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15+,17+,18+/m0/s1 |
| InChIKey | GJSSYQDXZLZOLR-QMHBMSAFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Roquefortine A (CHEBI:226437) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| [(6aR,9S,10R,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-g]quinolin-10-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 58828645 | ChemSpider |