EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O6 |
| Net Charge | 0 |
| Average Mass | 382.497 |
| Monoisotopic Mass | 382.23554 |
| SMILES | CC[C@H]1[C@H](O)C[C@@]2(O[C@@H]([C@@H](C)/C=C/C=C/C(=O)O)[C@@H](C)[C@@H](O)[C@@H]2C)O[C@@H]1C |
| InChI | InChI=1S/C21H34O6/c1-6-16-15(5)26-21(11-17(16)22)14(4)19(25)13(3)20(27-21)12(2)9-7-8-10-18(23)24/h7-10,12-17,19-20,22,25H,6,11H2,1-5H3,(H,23,24)/b9-7+,10-8+/t12-,13-,14-,15+,16+,17+,19+,20-,21-/m0/s1 |
| InChIKey | COFIVWDWWDQMEE-VQTSIWCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SCSGAA 0027 (ncbitaxon:2979574) | - | PubMed (28951600) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pteridic acid F (CHEBI:226428) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6S)-6-[(2S,3S,4R,5S,6S,8R,9S,10R)-9-ethyl-4,10-dihydroxy-3,5,8-trimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]hepta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62277912 | ChemSpider |