EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | C[C@H]1[C@@H](O)[C@H](C)[C@]2(C[C@@H](O)[C@H](C)[C@@H](C)O2)O[C@H]1[C@@H](C)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C20H32O6/c1-11(8-6-7-9-17(22)23)19-13(3)18(24)14(4)20(26-19)10-16(21)12(2)15(5)25-20/h6-9,11-16,18-19,21,24H,10H2,1-5H3,(H,22,23)/b8-6+,9-7+/t11-,12+,13-,14-,15+,16+,18+,19-,20-/m0/s1 |
| InChIKey | GYTVZXLCIFKWMV-QKDYPMQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SCSGAA 0027 (ncbitaxon:2979574) | - | PubMed (28951600) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pteridic acid E (CHEBI:226424) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6S)-6-[(2S,3S,4R,5S,6S,8R,9S,10R)-4,10-dihydroxy-3,5,8,9-tetramethyl-1,7-dioxaspiro[5.5]undecan-2-yl]hepta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62277911 | ChemSpider |