EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O6 |
| Net Charge | 0 |
| Average Mass | 342.432 |
| Monoisotopic Mass | 342.20424 |
| SMILES | C[C@H]1[C@@H](O)[C@H](C)[C@]2(C[C@@H](O)[C@H](C)[C@@H](C)O2)O[C@H]1[C@@H](C)/C=C/C(=O)O |
| InChI | InChI=1S/C18H30O6/c1-9(6-7-15(20)21)17-11(3)16(22)12(4)18(24-17)8-14(19)10(2)13(5)23-18/h6-7,9-14,16-17,19,22H,8H2,1-5H3,(H,20,21)/b7-6+/t9-,10+,11-,12-,13+,14+,16+,17-,18-/m0/s1 |
| InChIKey | LLALUPXXNUSSKT-DBVHRIDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SCSGAA 0027 (ncbitaxon:2979574) | - | PubMed (28951600) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pteridic acid D (CHEBI:226418) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E,4S)-4-[(2S,3S,4R,5S,6S,8R,9S,10R)-4,10-dihydroxy-3,5,8,9-tetramethyl-1,7-dioxaspiro[5.5]undecan-2-yl]pent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62277910 | ChemSpider |