EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40ClN3O3 |
| Net Charge | 0 |
| Average Mass | 466.066 |
| Monoisotopic Mass | 465.27582 |
| SMILES | C#CCCCC(=CCl)CC[C@@H](C)C=CCCC(=O)N[C@H](C)C(=O)N(C)[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C25H40ClN3O3/c1-7-8-9-13-21(17-26)16-15-19(4)12-10-11-14-22(30)28-20(5)25(32)29(6)23(18(2)3)24(27)31/h1,10,12,17-20,23H,8-9,11,13-16H2,2-6H3,(H2,27,31)(H,28,30)/t19-,20+,23-/m0/s1 |
| InChIKey | ZLFSNAGNVUVFPM-MZKRTTBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ianmoorea (ncbitaxon:619344) | - | PubMed (31071229) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vatiamide E (CHEBI:226416) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (6R)-N-[(2R)-1-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-methylamino]-1-oxopropan-2-yl]-9-(chloromethylidene)-6-methyltetradec-4-en-13-ynamide |