EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O6 |
| Net Charge | 0 |
| Average Mass | 356.459 |
| Monoisotopic Mass | 356.21989 |
| SMILES | CC[C@H]1[C@H](O)C[C@@]2(O[C@@H]([C@@H](C)/C=C/C(=O)O)[C@@H](C)[C@@H](O)[C@@H]2C)O[C@@H]1C |
| InChI | InChI=1S/C19H32O6/c1-6-14-13(5)24-19(9-15(14)20)12(4)17(23)11(3)18(25-19)10(2)7-8-16(21)22/h7-8,10-15,17-18,20,23H,6,9H2,1-5H3,(H,21,22)/b8-7+/t10-,11-,12-,13+,14+,15+,17+,18-,19-/m0/s1 |
| InChIKey | YCCKJDBCKPNDFZ-SIXBHZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SCSGAA 0027 (ncbitaxon:2979574) | - | PubMed (28951600) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pteridic acid C (CHEBI:226413) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E,4S)-4-[(2S,3S,4R,5S,6S,8R,9S,10R)-9-ethyl-4,10-dihydroxy-3,5,8-trimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]pent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62277909 | ChemSpider |