EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N4O7 |
| Net Charge | 0 |
| Average Mass | 534.654 |
| Monoisotopic Mass | 534.30535 |
| SMILES | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](CCO)NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H42N4O7/c1-7-17(4)22(27(37)38)30-25(35)21(15-16(2)3)31(6)26(36)18(5)28-24(34)20(13-14-32)29-23(33)19-11-9-8-10-12-19/h8-12,16-18,20-22,32H,7,13-15H2,1-6H3,(H,28,34)(H,29,33)(H,30,35)(H,37,38)/t17-,18-,20+,21+,22+/m1/s1 |
| InChIKey | NYHPEMZPVCCKHH-BJKUESEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stagonospora trichophoricola (ncbitaxon:1508255) | - | PubMed (28676717) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichopeptide A (CHEBI:226323) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-benzamido-4-hydroxybutanoyl]amino]propanoyl]-methylamino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438815 | ChemSpider |