EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N3O7 |
| Net Charge | 0 |
| Average Mass | 305.287 |
| Monoisotopic Mass | 305.12230 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCO)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O7/c1-5(12)9(18)13-6(2-3-15)10(19)14-7(11(20)21)4-8(16)17/h5-7,15H,2-4,12H2,1H3,(H,13,18)(H,14,19)(H,16,17)(H,20,21)/t5-,6-,7-/m0/s1 |
| InChIKey | OGSAEMMXCPDVRH-ACZMJKKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia glumae (ncbitaxon:337) | - | PubMed (18834606) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alanyl-L-homoserinyl-L-aspartic acid (CHEBI:226281) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-hydroxybutanoyl]amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437801 | ChemSpider |