EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O5S |
| Net Charge | 0 |
| Average Mass | 280.301 |
| Monoisotopic Mass | 280.04054 |
| SMILES | COc1cc(C(=O)O)c2c3c1C(=O)O[C@@H](C)[C@@H]3CS2 |
| InChI | InChI=1S/C13H12O5S/c1-5-7-4-19-11-6(12(14)15)3-8(17-2)10(9(7)11)13(16)18-5/h3,5,7H,4H2,1-2H3,(H,14,15)/t5-,7-/m0/s1 |
| InChIKey | VJIDDYWMOLKPQK-FSPLSTOPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromycesspecies (ncbitaxon:1707706) | - | PubMed (32315180) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talarolactone A (CHEBI:226240) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| (4R,5S)-9-methoxy-5-methyl-7-oxo-6-oxa-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-11-carboxylic acid |