EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O7 |
| Net Charge | 0 |
| Average Mass | 422.518 |
| Monoisotopic Mass | 422.23045 |
| SMILES | COc1cc(O)c(O)c2c1C(=O)O[C@@H]2CCCCCCCCC[C@@]1(O)CC[C@@H](C)O1 |
| InChI | InChI=1S/C23H34O7/c1-15-11-13-23(27,30-15)12-9-7-5-3-4-6-8-10-17-19-20(22(26)29-17)18(28-2)14-16(24)21(19)25/h14-15,17,24-25,27H,3-13H2,1-2H3/t15-,17-,23+/m1/s1 |
| InChIKey | MYKLWYLNYXNPHN-YAEBDLLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sporotrichum laxum (ncbitaxon:184472) | - | PubMed (17190462) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-6-Hydroxysporotricale (CHEBI:226229) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-4,5-dihydroxy-3-[9-[(2S,5R)-2-hydroxy-5-methyloxolan-2-yl]nonyl]-7-methoxy-3H-2-benzouran-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78442681 | ChemSpider |