EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45ClN4O7 |
| Net Charge | 0 |
| Average Mass | 681.230 |
| Monoisotopic Mass | 680.29768 |
| SMILES | CO[C@@H]1C(=O)O[C@H](C)[C@@H](C)/C=C(/C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2cnc3ccccc23)C(=O)NC1c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C36H45ClN4O7/c1-19-14-20(2)23(5)48-36(46)32(47-7)31(24-12-13-30(42)27(37)16-24)40-34(44)29(17-25-18-38-28-11-9-8-10-26(25)28)41(6)35(45)22(4)39-33(43)21(3)15-19/h8-14,16,18,20-23,29,31-32,38,42H,15,17H2,1-7H3,(H,39,43)(H,40,44)/b19-14-/t20-,21-,22-,23+,29+,31?,32-/m0/s1 |
| InChIKey | MWOUIFPDXGZUPG-XNUJQIKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces (ncbitaxon:50) | - | PubMed (23959765) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chrondramide 7 (CHEBI:226224) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,7R,10S,13S,15Z,17S,18R)-4-(3-chloro-4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 78442680 | ChemSpider |