EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3[C@](C)(C(=O)O)CC[C@@H](O)[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H26O6/c1-5-17(2)8-9-20(26)11(10-17)13(22)14(23)15-18(3,16(24)25)7-6-12(21)19(15,20)4/h5,10,12,21,23,26H,1,6-9H2,2-4H3,(H,24,25)/t12-,17+,18-,19+,20-/m1/s1 |
| InChIKey | IXDZJRZQORSJMR-ARALLLCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsisspecies S12 (ncbitaxon:556473) | - | DOI (10.1016/j.tetlet.2019.151045) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,4R,4aR,4bS,7R)-7-ethenyl-4,4b,10-trihydroxy-1,4a,7-trimethyl-9-oxo-3,4,5,6-tetrahydro-2H-phenanthrene-1-carboxylic acid (CHEBI:226207) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4R,4aR,4bS,7R)-7-ethenyl-4,4b,10-trihydroxy-1,4a,7-trimethyl-9-oxo-3,4,5,6-tetrahydro-2H-phenanthrene-1-carboxylic acid |