EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O6 |
| Net Charge | 0 |
| Average Mass | 348.310 |
| Monoisotopic Mass | 348.06339 |
| SMILES | O=C1c2c(O)ccc3c2[C@H](c2ccc(O)c4c2[C@H]3[C@H]2O[C@H]2C4=O)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C20H12O6/c21-7-3-1-5-9-12(18-20(26-18)15(23)13(7)9)6-2-4-8(22)14-10(6)11(5)17-19(25-17)16(14)24/h1-4,11-12,17-22H/t11-,12-,17+,18+,19-,20-/m0/s1 |
| InChIKey | CJGDIPRCPKGNLW-AHYXFKKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria alternata (ncbitaxon:5599) | - | PubMed (3546597) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin III (CHEBI:226194) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (2S,3R,5R,12S,13R,15R)-8,18-dihydroxy-4,14-dioxaheptacyclo[10.8.1.12,7.03,5.013,15.017,21.011,22]docosa-1(21),7,9,11(22),17,19-hexaene-6,16-dione |
| Manual Xrefs | Databases |
|---|---|
| 102847 | ChemSpider |