EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H20N2O7 |
| Net Charge | 0 |
| Average Mass | 472.453 |
| Monoisotopic Mass | 472.12705 |
| SMILES | CCC(=NNc1ccccc1C(=O)O)C(=O)c1cc2c(c(O)c1C)C(=O)C(=O)c1c(O)cccc1-2 |
| InChI | InChI=1S/C26H20N2O7/c1-3-17(27-28-18-9-5-4-7-14(18)26(34)35)23(31)15-11-16-13-8-6-10-19(29)20(13)24(32)25(33)21(16)22(30)12(15)2/h4-11,28-30H,3H2,1-2H3,(H,34,35) |
| InChIKey | OVLSTPLMOYWUTP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tetlet.2019.05.048) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Murayaquinone C (CHEBI:226163) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 2-[2-[1-(1,8-dihydroxy-2-methyl-9,10-dioxophenanthren-3-yl)-1-oxobutan-2-ylidene]hydrazinyl]benzoic acid |