EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38N8O7 |
| Net Charge | 0 |
| Average Mass | 502.573 |
| Monoisotopic Mass | 502.28635 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)C(N)C(N)CCC(O)C(O)CC1CN(C(N)=O)C(N)=N1)C(=O)O |
| InChI | InChI=1S/C20H38N8O7/c1-8(2)15(18(33)34)27-16(31)9(3)25-17(32)14(22)11(21)4-5-12(29)13(30)6-10-7-28(20(24)35)19(23)26-10/h8-15,29-30H,4-7,21-22H2,1-3H3,(H2,23,26)(H2,24,35)(H,25,32)(H,27,31)(H,33,34)/t9-,10?,11?,12?,13?,14?,15-/m0/s1 |
| InChIKey | YLQGBTCZCVMFGN-WOAUDBLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies K01-0509 (ncbitaxon:1238679) | - | PubMed (18503202) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guadinomine B (CHEBI:226159) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[2,3-diamino-8-(2-amino-1-carbamoyl-4,5-dihydroimidazol-4-yl)-6,7-dihydroxyoctanoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445695 | ChemSpider |