EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H20O6 |
| Net Charge | 0 |
| Average Mass | 428.440 |
| Monoisotopic Mass | 428.12599 |
| SMILES | CCCC(=O)c1cc2c(c(O)c1C)[C@@]1(OC(=O)c3ccccc31)C(=O)c1c(O)cccc1-2 |
| InChI | InChI=1S/C26H20O6/c1-3-7-19(27)16-12-17-14-9-6-11-20(28)21(14)24(30)26(22(17)23(29)13(16)2)18-10-5-4-8-15(18)25(31)32-26/h4-6,8-12,28-29H,3,7H2,1-2H3/t26-/m1/s1 |
| InChIKey | NIEMWTQGQMRYCB-AREMUKBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tetlet.2019.05.048) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-murayaquinone B (CHEBI:226152) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (3R)-3'-butanoyl-1',8'-dihydroxy-2'-methylspiro[2-benzouran-3,10'-phenanthrene]-1,9'-dione |