EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H47N5O6 |
| Net Charge | 0 |
| Average Mass | 633.790 |
| Monoisotopic Mass | 633.35263 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C35H47N5O6/c1-21(2)18-26-35(46)40-17-9-12-28(40)31(42)38-30(22(3)4)33(44)37-27(19-24-13-15-25(41)16-14-24)34(45)39(5)29(32(43)36-26)20-23-10-7-6-8-11-23/h6-8,10-11,13-16,21-22,26-30,41H,9,12,17-20H2,1-5H3,(H,36,43)(H,37,44)(H,38,42)/t26-,27-,28-,29-,30+/m0/s1 |
| InChIKey | DECSOYHXYHUQNR-VFFRCKCKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies MEXU 27854 (ncbitaxon:2801328) | - | DOI (10.1016/j.tetlet.2019.05.037) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caletasin (CHEBI:226142) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,9S,12R,15S)-6-benzyl-9-[(4-hydroxyphenyl)methyl]-7-methyl-3-(2-methylpropyl)-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone |