EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28O9 |
| Net Charge | 0 |
| Average Mass | 580.589 |
| Monoisotopic Mass | 580.17333 |
| SMILES | COc1cc(O)c2c(c1)[C@@]1(CC[C@@]3(O)c4cc(C)cc(O)c4C(=O)c4c(O)cc(OC)c1c43)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C34H28O9/c1-14-7-17-25(20(35)9-14)31(39)26-18(11-16(42-3)12-22(26)37)33(17)5-6-34(41)19-8-15(2)10-21(36)27(19)32(40)28-23(38)13-24(43-4)29(33)30(28)34/h7-13,35-38,41H,5-6H2,1-4H3/t33-,34-/m1/s1 |
| InChIKey | HESLOCMTQNZKEC-KKLWWLSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurotiumspecies SCSIO F452 (ncbitaxon:1246140) | - | DOI (10.1016/j.tetlet.2019.05.025) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Eurotone A (CHEBI:226132) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (3R,11bR)-1',6,8,8',11b-pentahydroxy-3',4-dimethoxy-6',10-dimethylspiro[1,2-dihydrobenzo[a]phenalene-3,10'-anthracene]-7,9'-dione |
| Manual Xrefs | Databases |
|---|---|
| 75320567 | ChemSpider |