EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H36N4O6 |
| Net Charge | 0 |
| Average Mass | 596.684 |
| Monoisotopic Mass | 596.26348 |
| SMILES | COC(=O)/C(Cc1cnc2c(/C=C/C3(C)CC(C=C(C)C)c4cccc5c(C/C(=N\O)C(=O)OC)cn3c45)cccc12)=N/O |
| InChI | InChI=1S/C34H36N4O6/c1-20(2)14-22-17-34(3,38-19-24(16-29(37-42)33(40)44-5)27-11-7-10-26(22)31(27)38)13-12-21-8-6-9-25-23(18-35-30(21)25)15-28(36-41)32(39)43-4/h6-14,18-19,22,35,41-42H,15-17H2,1-5H3/b13-12+,36-28+,37-29+ |
| InChIKey | GFRJOLDSNWWDNT-QOJUGUOESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conoideocrella (ncbitaxon:1105318) | - | DOI (10.1016/j.tetlet.2018.12.004) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Conoideoxime A (CHEBI:226117) is a indolyl carboxylic acid (CHEBI:46867) |