EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O7 |
| Net Charge | 0 |
| Average Mass | 454.519 |
| Monoisotopic Mass | 454.19915 |
| SMILES | COC(=O)c1cc(-c2ccc3c(c2)O[C@@]2(CO3)O[C@H](C=C(C)C)OC2(C)C)cc(OC)c1C |
| InChI | InChI=1S/C26H30O7/c1-15(2)10-23-32-25(4,5)26(33-23)14-30-20-9-8-17(12-22(20)31-26)18-11-19(24(27)29-7)16(3)21(13-18)28-6/h8-13,23H,14H2,1-7H3/t23-,26+/m1/s1 |
| InChIKey | MDYUXLRGMFXISP-BVAGGSTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Favolaschia (ncbitaxon:139071) | - | PubMed (32193929) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Favolasin E (CHEBI:226005) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| methyl 5-[(2R,4S)-5,5-dimethyl-2-(2-methylprop-1-enyl)spiro[1,3-dioxolane-4,3'-2H-1,4-benzodioxine]-6'-yl]-3-methoxy-2-methylbenzoate |