EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56N2O11 |
| Net Charge | 0 |
| Average Mass | 692.847 |
| Monoisotopic Mass | 692.38841 |
| SMILES | CCC(C)C1C(=O)OC(C(C)C/C=C/C[C@@H](C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)CC(O)C(C)C(=O)NC(Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C36H56N2O11/c1-7-20(2)29-35(46)48-27(21(3)13-11-12-14-22(4)47-36-32(43)31(42)30(41)28(19-39)49-36)18-26(40)23(5)33(44)37-25(34(45)38(29)6)17-24-15-9-8-10-16-24/h8-12,15-16,20-23,25-32,36,39-43H,7,13-14,17-19H2,1-6H3,(H,37,44)/b12-11+/t20?,21?,22-,23?,25?,26?,27?,28-,29?,30-,31+,32+,36-/m1/s1 |
| InChIKey | BXELSXHTVDMWEF-KVBLJALFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:5455) | - | PubMed (31430150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletotrichamide B (CHEBI:225998) is a cyclodepsipeptide (CHEBI:35213) |
| Colletotrichamide B (CHEBI:225998) is a glycoside (CHEBI:24400) |
| IUPAC Name |
|---|
| 6-benzyl-3-butan-2-yl-10-hydroxy-4,9-dimethyl-12-[(E,7R)-7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoct-4-en-2-yl]-1-oxa-4,7-diazacyclododecane-2,5,8-trione |