EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O10 |
| Net Charge | 0 |
| Average Mass | 442.376 |
| Monoisotopic Mass | 442.09000 |
| SMILES | COc1c(O)c(-c2c(O)c(OC)c(O)c3c(=O)oc(C)cc23)c2cc(C)oc(=O)c2c1O |
| InChI | InChI=1S/C22H18O10/c1-7-5-9-11(15(23)19(29-3)17(25)13(9)21(27)31-7)12-10-6-8(2)32-22(28)14(10)18(26)20(30-4)16(12)24/h5-6,23-26H,1-4H3 |
| InChIKey | KPZMGGATZAUIMT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21224860) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bireticulol (CHEBI:225976) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 5-(6,8-dihydroxy-7-methoxy-3-methyl-1-oxoisochromen-5-yl)-6,8-dihydroxy-7-methoxy-3-methylisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 28288565 | ChemSpider |