EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N6O8S |
| Net Charge | 0 |
| Average Mass | 532.535 |
| Monoisotopic Mass | 532.13763 |
| SMILES | COC(=O)c1ccccc1NC(=O)[C@H](CCS(C)(=O)=O)NC(=O)c1cnc2c(n1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H24N6O8S/c1-27-17-16(20(31)28(2)22(27)33)24-15(11-23-17)19(30)26-14(9-10-37(4,34)35)18(29)25-13-8-6-5-7-12(13)21(32)36-3/h5-8,11,14H,9-10H2,1-4H3,(H,25,29)(H,26,30)/t14-/m0/s1 |
| InChIKey | RJLPKFRRHLDCSV-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25001296) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penilumamide C (CHEBI:225974) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| methyl 2-[[(2S)-2-[(1,3-dimethyl-2,4-dioxopteridine-6-carbonyl)amino]-4-methylsulonylbutanoyl]amino]benzoate |
| Manual Xrefs | Databases |
|---|---|
| 34981205 | ChemSpider |