EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CC(=CCO)CC1=C(CC(=O)O)[C@]2(C)CCCC(C)(C)[C@H]2CC1 |
| InChI | InChI=1S/C20H32O3/c1-14(8-11-21)12-15-6-7-17-19(2,3)9-5-10-20(17,4)16(15)13-18(22)23/h8,17,21H,5-7,9-13H2,1-4H3,(H,22,23)/t17-,20+/m1/s1 |
| InChIKey | AUMLCVNLZJLOHA-XLIONFOSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (28096549) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Decatamariic acid (CHEBI:225947) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-[(4aR,8aR)-2-(4-hydroxy-2-methylbut-2-enyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid |