EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O7 |
| Net Charge | 0 |
| Average Mass | 528.686 |
| Monoisotopic Mass | 528.30870 |
| SMILES | CC1=C(C)[C@@]2(C[C@@H](C)[C@H]3[C@H](C[C@@]4(C)C5=C[C@@H](O)[C@]6(O)C(C)(C)[C@H](O)C[C@@H](O)[C@]6(C)C5=CC[C@]34C)O2)OC1=O |
| InChI | InChI=1S/C31H44O7/c1-15-13-30(17(3)16(2)25(35)38-30)37-20-14-28(7)19-11-23(34)31(36)26(4,5)21(32)12-22(33)29(31,8)18(19)9-10-27(28,6)24(15)20/h9,11,15,20-24,32-34,36H,10,12-14H2,1-8H3/t15-,20+,21-,22-,23-,24+,27-,28+,29+,30-,31+/m1/s1 |
| InChIKey | NCXCIHGEYIWMTJ-WXFZHYSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Irpex lacteus (ncbitaxon:5319) | - | PubMed (30673259) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Irpexolide A (CHEBI:225941) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2R,4S,6R,8R,9R,10R,14S,15R,17R,19S,20R)-15,17,19,20-tetrahydroxy-2,3',4',8,10,14,18,18-octamethylspiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(21),12-diene-6,5'-uran]-2'-one |