EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O6 |
| Net Charge | 0 |
| Average Mass | 420.546 |
| Monoisotopic Mass | 420.25119 |
| SMILES | CC[C@@H](C)[C@H]1C=C[C@H]2[C@H](O)[C@H](OC(=O)/C=C(\C)CC(=O)O)C[C@@H](C)[C@@H]2[C@@]1(C)C(C)=O |
| InChI | InChI=1S/C24H36O6/c1-7-14(3)18-9-8-17-22(24(18,6)16(5)25)15(4)12-19(23(17)29)30-21(28)11-13(2)10-20(26)27/h8-9,11,14-15,17-19,22-23,29H,7,10,12H2,1-6H3,(H,26,27)/b13-11+/t14-,15-,17-,18-,19-,22+,23+,24+/m1/s1 |
| InChIKey | FUTZVCABGNACKX-QKIFKDKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomycesspecies (ncbitaxon:40383) | - | PubMed (9868170) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deoxynortrichoharzin (CHEBI:225939) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (E)-5-[[(1S,2R,4R,4aS,5S,6S,8aR)-5-acetyl-6-[(2R)-butan-2-yl]-1-hydroxy-4,5-dimethyl-2,3,4,4a,6,8a-hexahydro-1H-naphthalen-2-yl]oxy]-3-methyl-5-oxopent-3-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8821162 | ChemSpider |