EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H51N5O7 |
| Net Charge | 0 |
| Average Mass | 641.810 |
| Monoisotopic Mass | 641.37885 |
| SMILES | CCCC[C@H](C)[C@@H]1CC(=O)NCC(=O)N2CCC[C@H]2C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C34H51N5O7/c1-6-7-12-22(4)28-19-29(40)35-20-30(41)39-16-11-15-27(39)33(44)37-25(17-21(2)3)32(43)36-23(5)31(42)38-26(34(45)46-28)18-24-13-9-8-10-14-24/h8-10,13-14,21-23,25-28H,6-7,11-12,15-20H2,1-5H3,(H,35,40)(H,36,43)(H,37,44)(H,38,42)/t22-,23-,25+,26-,27-,28-/m0/s1 |
| InChIKey | OGCJZGBAJYYAKH-XJSWZFTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (30609359) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chrysogeamide F (CHEBI:225925) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (7S,10S,13S,16R,19S)-10-benzyl-7-[(2S)-hexan-2-yl]-13-methyl-16-(2-methylpropyl)-8-oxa-1,4,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
| Manual Xrefs | Databases |
|---|---|
| 71116017 | ChemSpider |