EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N3O4 |
| Net Charge | 0 |
| Average Mass | 271.317 |
| Monoisotopic Mass | 271.15321 |
| SMILES | CC(C)[C@H](N)C(=O)NC(C(=O)O)C1CC(O)C2CN21 |
| InChI | InChI=1S/C12H21N3O4/c1-5(2)9(13)11(17)14-10(12(18)19)6-3-8(16)7-4-15(6)7/h5-10,16H,3-4,13H2,1-2H3,(H,14,17)(H,18,19)/t6?,7?,8?,9-,10?,15?/m0/s1 |
| InChIKey | OWRDBHAORITUMQ-NUPLKXSGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SANK 60404 (ncbitaxon:1213862) | - | PubMed (28288097) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vazabitide A (CHEBI:225923) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(4-hydroxy-1-azabicyclo[3.1.0]hexan-2-yl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 58825798 | ChemSpider |