EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39N3O6 |
| Net Charge | 0 |
| Average Mass | 465.591 |
| Monoisotopic Mass | 465.28389 |
| SMILES | C=C1C=CC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)O[C@@H]([C@H](C)C[C@@H](C)CCC)[C@H](OC)C(=O)N1 |
| InChI | InChI=1S/C24H39N3O6/c1-8-9-15(4)12-16(5)21-22(32-7)23(30)26-17(6)10-11-18(28)25-13-19(29)27-20(14(2)3)24(31)33-21/h10-11,14-16,20-22H,6,8-9,12-13H2,1-5,7H3,(H,25,28)(H,26,30)(H,27,29)/t15-,16+,20-,21-,22-/m0/s1 |
| InChIKey | KRASFEIPFGADRT-LHXUZLEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsisspecies (ncbitaxon:310350) | - | PubMed (32186874) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Boholamide A (CHEBI:225916) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,14S,15S)-14-methoxy-15-[(2R,4S)-4-methylheptan-2-yl]-11-methylidene-3-propan-2-yl-1-oxa-4,7,12-triazacyclopentadec-9-ene-2,5,8,13-tetrone |