EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO7 |
| Net Charge | 0 |
| Average Mass | 321.285 |
| Monoisotopic Mass | 321.08485 |
| SMILES | C[C@@H](C(=O)O)[C@@H]1Cc2c(cc3c(c2O)CN(CC(=O)O)C3=O)O1 |
| InChI | InChI=1S/C15H15NO7/c1-6(15(21)22)10-3-8-11(23-10)2-7-9(13(8)19)4-16(14(7)20)5-12(17)18/h2,6,10,19H,3-5H2,1H3,(H,17,18)(H,21,22)/t6-,10+/m1/s1 |
| InChIKey | BJKOERVLRQSJPG-LDWIPMOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crucibulum (ncbitaxon:68774) | - | PubMed (7622427) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salfredin A4 (CHEBI:225845) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-[(2S)-6-(carboxymethyl)-4-hydroxy-7-oxo-3,5-dihydro-2H-uro[2,3-]isoindol-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8646701 | ChemSpider |