EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N4O2 |
| Net Charge | 0 |
| Average Mass | 426.520 |
| Monoisotopic Mass | 426.20558 |
| SMILES | C=CC(C)(C)[C@@]12C[C@H]3c4nc5ccccc5c(=O)n4[C@H](C)C(=O)N3[C@@H]1Nc1ccccc12 |
| InChI | InChI=1S/C26H26N4O2/c1-5-25(3,4)26-14-20-21-27-18-12-8-6-10-16(18)23(32)29(21)15(2)22(31)30(20)24(26)28-19-13-9-7-11-17(19)26/h5-13,15,20,24,28H,1,14H2,2-4H3/t15-,20+,24+,26-/m1/s1 |
| InChIKey | DNOJISVGBFLJOQ-BXVKCURFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fischeri (ncbitaxon:36630) | - | PubMed (8478256) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ardeemin (CHEBI:225749) is a indole alkaloid (CHEBI:38958) |
| ardeemin (CHEBI:225749) is a organic heterohexacyclic compound (CHEBI:51914) |
| IUPAC Name |
|---|
| (7R,9aS,14bR,15aS)-7-methyl-14b-(2-methylbut-3-en-2-yl)-10,14b,15,15a-tetrahydroindolo[3'',2'':4',5']pyrrolo[2',1':3,4]pyrazino[2,1-b]quinazoline-5,8(7H,9aH)-dione |
| Synonym | Source |
|---|---|
| (-)-ardeemin | ChEBI |
| Citations |
|---|