EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O6 |
| Net Charge | 0 |
| Average Mass | 474.638 |
| Monoisotopic Mass | 474.29814 |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@H]2C3=C(C(=O)C[C@]12C)[C@@]1(C)CC[C@@H](O)[C@H](O)[C@@H]1C[C@@H]3O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C28H42O6/c1-14(16(3)26(33)34)6-7-15(2)17-8-9-18-23-21(30)12-19-25(32)20(29)10-11-27(19,4)24(23)22(31)13-28(17,18)5/h15-21,25,29-30,32H,1,6-13H2,2-5H3,(H,33,34)/t15-,16-,17-,18+,19+,20-,21+,25-,27+,28-/m1/s1 |
| InChIKey | GBHCASQTLCYQBV-NJKFEIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:2696576) | - | PubMed (31891260) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antcamphorol D (CHEBI:225736) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2R,6R)-2-methyl-3-methylidene-6-[(3R,4R,5R,7S,10S,13R,14R,17R)-3,4,7-trihydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]heptanoic acid |