EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O5 |
| Net Charge | 0 |
| Average Mass | 460.655 |
| Monoisotopic Mass | 460.31887 |
| SMILES | C/C=C(/CO)CC[C@@H](C)[C@H]1CC[C@H]2C3=C(C(=O)C[C@]12C)[C@@]1(C)CC[C@@H](O)[C@](C)(O)[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C28H44O5/c1-6-17(15-29)8-7-16(2)18-9-10-19-24-20(30)13-22-26(3,12-11-23(32)28(22,5)33)25(24)21(31)14-27(18,19)4/h6,16,18-20,22-23,29-30,32-33H,7-15H2,1-5H3/b17-6+/t16-,18-,19+,20+,22-,23-,26+,27-,28-/m1/s1 |
| InChIKey | XBLLVTMPRLZIAG-SOLDAZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:2696576) | - | PubMed (31891260) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antcamphorol B (CHEBI:225726) has role androgen (CHEBI:50113) |
| Antcamphorol B (CHEBI:225726) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3R,4R,5R,7S,10S,13R,14R,17R)-3,4,7-trihydroxy-17-[(E,2R)-5-(hydroxymethyl)hept-5-en-2-yl]-4,10,13-trimethyl-2,3,5,6,7,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one |