EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O4 |
| Net Charge | 0 |
| Average Mass | 290.359 |
| Monoisotopic Mass | 290.15181 |
| SMILES | CC(=O)[C@@H](C)[C@H](O)[C@@H](C)c1ccc(C)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C17H22O4/c1-10-5-7-15(14(9-10)6-8-16(19)20)12(3)17(21)11(2)13(4)18/h5-9,11-12,17,21H,1-4H3,(H,19,20)/b8-6+/t11-,12+,17+/m1/s1 |
| InChIKey | CYBWDGOHPIQERY-DTURAIEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31904958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benwamycin E (CHEBI:225657) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (E)-3-[2-[(2S,3R,4S)-3-hydroxy-4-methyl-5-oxohexan-2-yl]-5-methylphenyl]prop-2-enoic acid |