EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | COC(=O)c1ccc(C2OC2C)cn1 |
| InChI | InChI=1S/C10H11NO3/c1-6-9(14-6)7-3-4-8(11-5-7)10(12)13-2/h3-6,9H,1-2H3 |
| InChIKey | DLDOQXDHLFJKLM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyricularia oryzae (ncbitaxon:318829) | - | PubMed (20379215) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caripyrin (CHEBI:225644) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| methyl 5-(3-methyloxiran-2-yl)pyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78435056 | ChemSpider |