EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13ClO4 |
| Net Charge | 0 |
| Average Mass | 256.685 |
| Monoisotopic Mass | 256.05024 |
| SMILES | CCC[C@@H]1Cc2c(O)c(Cl)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C12H13ClO4/c1-2-3-6-4-7-10(12(16)17-6)9(14)5-8(13)11(7)15/h5-6,14-15H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | SEIIWAQCIOACJZ-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | DOI (10.1002/ejoc.200801052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomolactone A (CHEBI:225632) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-6-chloro-5,8-dihydroxy-3-propyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78437787 | ChemSpider |