EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | COc1ccc(C(=O)O[C@@H]2C[C@@H](Cc3ccccc3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H20O6/c1-23-16-9-8-14(11-17(16)24-2)19(21)26-18-12-15(25-20(18)22)10-13-6-4-3-5-7-13/h3-9,11,15,18H,10,12H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | QYMIMSVMPMWPGS-CRAIPNDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma (ncbitaxon:5543) | - | PubMed (31886665) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichoderolide F (CHEBI:225622) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(3R,5R)-5-benzyl-2-oxooxolan-3-yl] 3,4-dimethoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 81367104 | ChemSpider |