EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26ClNO3 |
| Net Charge | 0 |
| Average Mass | 351.874 |
| Monoisotopic Mass | 351.16012 |
| SMILES | COC[C@](Cl)(CCC(C)=C(C)C)[C@H]1Cc2cc(C(=O)O)ccc2N1 |
| InChI | InChI=1S/C19H26ClNO3/c1-12(2)13(3)7-8-19(20,11-24-4)17-10-15-9-14(18(22)23)5-6-16(15)21-17/h5-6,9,17,21H,7-8,10-11H2,1-4H3,(H,22,23)/t17-,19-/m1/s1 |
| InChIKey | LMVQBWLTOJJHCT-IEBWSBKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A-503451 A (CHEBI:225620) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-[(2S)-2-chloro-1-methoxy-5,6-dimethylhept-5-en-2-yl]-2,3-dihydro-1H-indole-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438771 | ChemSpider |