EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:225589 - Euvesperin A
| Formula | C16H27NO5 |
| Net Charge | 0 |
| Average Mass | 313.394 |
| Monoisotopic Mass | 313.18892 |
| SMILES | CCCCCCC(C)(O)C(=O)C12OC1C(O)(C(C)C)NC2=O |
| InChI | InChI=1S/C16H27NO5/c1-5-6-7-8-9-14(4,20)11(18)15-12(22-15)16(21,10(2)3)17-13(15)19/h10,12,20-21H,5-9H2,1-4H3,(H,17,19) |
| InChIKey | BYUPZWWVBGDJCD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Keithomyces acicularis (ncbitaxon:2597650) | - | PubMed (26758491) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euvesperin A (CHEBI:225589) is a azetidine-2-carboxylic acid (CHEBI:38108) |
| Euvesperin A (CHEBI:225589) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 4-hydroxy-1-(2-hydroxy-2-methyloctanoyl)-4-propan-2-yl-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78444455 | ChemSpider |