EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO5 |
| Net Charge | 0 |
| Average Mass | 313.394 |
| Monoisotopic Mass | 313.18892 |
| SMILES | CCCCCCC(C)(O)C(=O)C12OC1C(O)(C(C)C)NC2=O |
| InChI | InChI=1S/C16H27NO5/c1-5-6-7-8-9-14(4,20)11(18)15-12(22-15)16(21,10(2)3)17-13(15)19/h10,12,20-21H,5-9H2,1-4H3,(H,17,19) |
| InChIKey | BYUPZWWVBGDJCD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Keithomyces acicularis (ncbitaxon:2597650) | - | PubMed (26758491) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euvesperin A (CHEBI:225589) is a azetidine-2-carboxylic acid (CHEBI:38108) |
| Euvesperin A (CHEBI:225589) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 4-hydroxy-1-(2-hydroxy-2-methyloctanoyl)-4-propan-2-yl-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78444455 | ChemSpider |