EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COc1cc(O)c2c3c(c(C)cc(C(=O)O)c13)[C@H](OC)OC2=O |
| InChI | InChI=1S/C16H14O7/c1-6-4-7(14(18)19)11-9(21-2)5-8(17)12-13(11)10(6)16(22-3)23-15(12)20/h4-5,16-17H,1-3H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | VBWGQALOJFJFIS-MRXNPFEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (33296194) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isopyrenulin (CHEBI:225531) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| (4R)-12-hydroxy-4,10-dimethoxy-6-methyl-2-oxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-8-carboxylic acid |