EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O9 |
| Net Charge | 0 |
| Average Mass | 350.279 |
| Monoisotopic Mass | 350.06378 |
| SMILES | COc1cc(O)c(C(=O)O)c(C2=COC(C(=O)O)=C[C@H]2C)c1C(=O)O |
| InChI | InChI=1S/C16H14O9/c1-6-3-10(14(18)19)25-5-7(6)11-12(15(20)21)8(17)4-9(24-2)13(11)16(22)23/h3-6,17H,1-2H3,(H,18,19)(H,20,21)(H,22,23)/t6-/m1/s1 |
| InChIKey | AUUUYYZURLSCCX-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (33296194) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penipyranicin C (CHEBI:225526) is a 2-hydroxyisophthalic acid (CHEBI:19643) |
| IUPAC Name |
|---|
| 2-[(4R)-6-carboxy-4-methyl-4H-pyran-3-yl]-4-hydroxy-6-methoxybenzene-1,3-dicarboxylic acid |