EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O7 |
| Net Charge | 0 |
| Average Mass | 306.270 |
| Monoisotopic Mass | 306.07395 |
| SMILES | COc1cc(O)c(C(=O)O)c(C2=COC(C(=O)O)=C[C@H]2C)c1 |
| InChI | InChI=1S/C15H14O7/c1-7-3-12(14(17)18)22-6-10(7)9-4-8(21-2)5-11(16)13(9)15(19)20/h3-7,16H,1-2H3,(H,17,18)(H,19,20)/t7-/m1/s1 |
| InChIKey | BLBVLBOSKQWCMZ-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (33296194) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penipyranicin B (CHEBI:225521) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| (4R)-5-(2-carboxy-3-hydroxy-5-methoxyphenyl)-4-methyl-4H-pyran-2-carboxylic acid |