EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O2 |
| Net Charge | 0 |
| Average Mass | 240.262 |
| Monoisotopic Mass | 240.08988 |
| SMILES | CCc1nc(C(=O)O)cc2c1nc1ccccc12 |
| InChI | InChI=1S/C14H12N2O2/c1-2-10-13-9(7-12(15-10)14(17)18)8-5-3-4-6-11(8)16-13/h3-7,16H,2H2,1H3,(H,17,18) |
| InChIKey | DAPZVPLVUVKDIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | DOI (10.1016/j.phytol.2013.06.007) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-ethyl-beta-carboline-3-carboxylic acid (CHEBI:225519) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 14553214 | ChemSpider |