EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O6S |
| Net Charge | 0 |
| Average Mass | 376.430 |
| Monoisotopic Mass | 376.09806 |
| SMILES | CC/C=C/C=C/[C@@]1(C)OC(c2cc(C(=O)O)sc2C)=C(C(=O)OC)C1=O |
| InChI | InChI=1S/C19H20O6S/c1-5-6-7-8-9-19(3)16(20)14(18(23)24-4)15(25-19)12-10-13(17(21)22)26-11(12)2/h6-10H,5H2,1-4H3,(H,21,22)/b7-6+,9-8+/t19-/m1/s1 |
| InChIKey | LLUVJCXYOGCDRG-KIKMEVCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (33314934) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiocarboxylic B (CHEBI:225458) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 4-[(5R)-5-[(1E,3E)-hexa-1,3-dienyl]-3-methoxycarbonyl-5-methyl-4-oxouran-2-yl]-5-methylthiophene-2-carboxylic acid |