EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N2O3 |
| Net Charge | 0 |
| Average Mass | 216.281 |
| Monoisotopic Mass | 216.14739 |
| SMILES | CCCC(O)/C=C/[N+]([O-])=NC(C)C(C)O |
| InChI | InChI=1S/C10H20N2O3/c1-4-5-10(14)6-7-12(15)11-8(2)9(3)13/h6-10,13-14H,4-5H2,1-3H3/b7-6+,12-11? |
| InChIKey | STZRYOCJRPONFG-WQAKAUOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies TOHO-M025 (ncbitaxon:1629616) | - | PubMed (26648117) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maniwamycin C (CHEBI:225442) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-hydroxybutan-2-ylimino-[(E)-3-hydroxyhex-1-enyl]-oxidoazanium |
| Manual Xrefs | Databases |
|---|---|
| 78444449 | ChemSpider |