EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N4O5 |
| Net Charge | 0 |
| Average Mass | 432.436 |
| Monoisotopic Mass | 432.14337 |
| SMILES | O=C1Nc2ccccc2C(=O)n2cc(c3ccccc32)C[C@H]([N+](=O)[O-])C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C23H20N4O5/c28-21-19-10-5-11-25(19)23(30)20(27(31)32)12-14-13-26(18-9-4-2-6-15(14)18)22(29)16-7-1-3-8-17(16)24-21/h1-4,6-9,13,19-20H,5,10-12H2,(H,24,28)/t19-,20-/m0/s1 |
| InChIKey | YQOXDTHSLKEXLH-PMACEKPBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium ribium (ncbitaxon:357993) | - | PubMed (15165155) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Psychrophilin A (CHEBI:225387) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (11S,17S)-17-nitro-1,9,15-triazapentacyclo[17.6.1.03,8.011,15.020,25]hexacosa-3,5,7,19(26),20,22,24-heptaene-2,10,16-trione |
| Manual Xrefs | Databases |
|---|---|
| 10190610 | ChemSpider |